| Name(s) | trans-p-coumaric acid 4-glucoside |
|---|---|
| Scientific name(s) | |
| Formula | C15H18O8 |
| Molecular mass | 326.2986 |
| IUPAC name | (2E)-3-(4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid |
| INCHI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+ |
| SMILE | OCC1OC(OC2=CC=C(\C=C\C(O)=O)C=C2)C(O)C(O)C1O |
| CAS ID | 14364-05-7 |
| PubChem ID | 9840292 |
| DrugBank ID | Not available |
| CHEBI ID | 17335 |
| Description | Constituent of Brassica subspecies and other plant subspecies trans-p-Coumaric acid 4-glucoside is found in many foods, some of which are red raspberry, brassicas, blackcurrant, and strawberry. |
|---|