| Name(s) | moracin l |
|---|---|
| Scientific name(s) | |
| Formula | C19H16O5 |
| Molecular mass | 324.3273 |
| IUPAC name | 5-{8-hydroxy-12-methyl-3,10-dioxatricyclo[7.5.0.0²,?]tetradeca-1,4,6,8,12-pentaen-4-yl}benzene-1,3-diol |
| INCHI | InChI=1S/C19H16O5/c1-10-2-3-15-18-12(6-16(22)19(15)23-9-10)7-17(24-18)11-4-13(20)8-14(21)5-11/h2,4-8,20-22H,3,9H2,1H3 |
| SMILE | CC1=CCC2=C3OC(=CC3=CC(O)=C2OC1)C1=CC(O)=CC(O)=C1 |
| CAS ID | 73338-91-7 |
| PubChem ID | Not available |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Production by Morus alba (white mulberry) infected with Fusarium solani. Moracin L is found in mulberry and fruits. |
|---|