| Name(s) | (s)-alpha-terpineol |
|---|---|
| Scientific name(s) | |
| Formula | C10H18O |
| Molecular mass | 154.2493 |
| IUPAC name | 2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| INCHI | InChI=1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m0/s1 |
| SMILE | CC1=CC[C@@H](CC1)C(C)(C)O |
| CAS ID | 10482-56-1 |
| PubChem ID | 443162 |
| DrugBank ID | Not available |
| CHEBI ID | 128 |
| Description | Terpineol is a naturally occurring monoterpene alcohol that has been isolated from a variety of sources such as cajuput oil, pine oil, and petitgrain oil. There are three isomers, alpha-, beta-, and gamma-terpineol, the last two differing only by the location of the double bond. Terpineol is usually a mixture of these isomers with alpha-terpineol as the major constituent. (S)-alpha-Terpineol is found in cinnamon, sweet bay, and mentha (mint). |
|---|