| Name(s) | mg(16:0/0:0/0:0) |
|---|---|
| Scientific name(s) | |
| Formula | C19H38O4 |
| Molecular mass | 330.5026 |
| IUPAC name | (2S)-2,3-dihydroxypropyl hexadecanoate |
| INCHI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3/t18-/m0/s1 |
| SMILE | [H][C@](O)(CO)COC(=O)CCCCCCCCCCCCCCC |
| CAS ID | 32899-41-5 |
| PubChem ID | 3084463 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | MG(16:0/0:0/0:0) belongs to the family of monoradyglycerols, which are glycerolipids lipids containing a common glycerol backbone to which at one fatty acyl group is attached. Their general formula is [R1]OCC(CO[R2])O[R3]. MG(16:0/0:0/0:0) is made up of one hexadecanoyl(R1). |
|---|