mg(0:0/18:0/0:0)
| Name(s) | mg(0:0/18:0/0:0) |
|---|---|
| Scientific name(s) | |
| Formula | C21H42O4 |
| Molecular mass | 358.5558 |
| IUPAC name | 1,3-dihydroxypropan-2-yl octadecanoate |
| INCHI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h20,22-23H,2-19H2,1H3 |
| SMILE | [H]C(CO)(CO)OC(=O)CCCCCCCCCCCCCCCCC |
| CAS ID | 621-61-4 |
| PubChem ID | 79075 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | MG(0:0/18:0/0:0) belongs to the family of monoradyglycerols, which are glycerolipids lipids containing a common glycerol backbone to which at one fatty acyl group is attached. Their general formula is [R1]OCC(CO[R2])O[R3]. MG(0:0/18:0/0:0) is made up of one octadecanoyl(R2). |
|---|