| Name(s) | dg(18:0/18:1(9z)/0:0) |
|---|---|
| Scientific name(s) | |
| Formula | C39H74O5 |
| Molecular mass | 623.0019 |
| IUPAC name | (2S)-1-hydroxy-3-(octadecanoyloxy)propan-2-yl octadec-9-enoate |
| INCHI | InChI=1S/C39H74O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h18,20,37,40H,3-17,19,21-36H2,1-2H3/t37-/m0/s1 |
| SMILE | [H][C@](CO)(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| CAS ID | 53702-48-0 |
| PubChem ID | 6443547 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | DG(18:0/18:1(9Z)/0:0) belongs to the family of Diacylglycerols. These are glycerolipids lipids containing a common glycerol backbone to which at least one fatty acyl group is esterified. DG(18:0/18:1(9Z)/0:0) is also a substrate of diacylglycerol kinase. It is involved in the phospholipid metabolic pathway. |
|---|