| Name(s) | dg(16:0/16:0/0:0) |
|---|---|
| Scientific name(s) | |
| Formula | C35H68O5 |
| Molecular mass | 568.9114 |
| IUPAC name | (2S)-1-(hexadecanoyloxy)-3-hydroxypropan-2-yl hexadecanoate |
| INCHI | InChI=1S/C35H68O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(37)39-32-33(31-36)40-35(38)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33,36H,3-32H2,1-2H3/t33-/m1/s1 |
| SMILE | [H][C@@](CO)(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC |
| CAS ID | 30334-71-5 |
| PubChem ID | 644078 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | DG(16:0/16:0/0:0) belongs to the family of Diacylglycerols. These are glycerolipids lipids containing a common glycerol backbone to which at least one fatty acyl group is esterified. DG(16:0/16:0/0:0) is also a substrate of diacylglycerol kinase. It is involved in the phospholipid metabolic pathway. |
|---|