rose oxide
| Name(s) | rose oxide |
|---|---|
| Scientific name(s) | |
| Formula | C10H18O |
| Molecular mass | 154.2493 |
| IUPAC name | 4-methyl-2-(2-methylprop-1-en-1-yl)oxane |
| INCHI | InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3 |
| SMILE | CC1CCOC(C1)C=C(C)C |
| CAS ID | 16409-43-1 |
| PubChem ID | 27866 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Flavouring ingredient. Rose oxide is found in many foods, some of which are peppermint, ginger, lemon balm, and black elderberry. |
|---|