(±)-menthyl acetate
| Name(s) | (±)-menthyl acetate |
|---|---|
| Scientific name(s) | |
| Formula | C12H22O2 |
| Molecular mass | 198.3019 |
| IUPAC name | (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl acetate |
| INCHI | InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m0/s1 |
| SMILE | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(C)=O |
| CAS ID | 89-48-5 |
| PubChem ID | 220674 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Component of peppermint oil. (±)-Menthyl acetate is found in many foods, some of which are herbs and spices, spearmint, cornmint, and ginger. |
|---|