(+)-beta-phellandrene
| Name(s) | (+)-beta-phellandrene |
|---|---|
| Scientific name(s) | |
| Formula | C10H16 |
| Molecular mass | 136.234 |
| IUPAC name | (6S)-3-methylidene-6-(propan-2-yl)cyclohex-1-ene |
| INCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3/t10-/m0/s1 |
| SMILE | [H][C@]1(CCC(=C)C=C1)C(C)C |
| CAS ID | 6153-16-8 |
| PubChem ID | 442484 |
| DrugBank ID | Not available |
| CHEBI ID | 53 |
| Description | Phellandrene is the name for a pair of organic compounds that have a similar molecular structure and similar chemical properties. alpha-Phellandrene and beta-phellandrene are cyclic monoterpenes and are double-bond isomers. The phellandrenes are used in fragrances because of their pleasing aromas. (+)-beta-Phellandrene is found in ginger. |
|---|