| Name(s) | cis-linalool 3,6-oxide |
|---|---|
| Scientific name(s) | |
| Formula | C10H18O2 |
| Molecular mass | 170.2487 |
| IUPAC name | 2-[(2R,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-ol |
| INCHI | InChI=1S/C10H18O2/c1-5-10(4)7-6-8(12-10)9(2,3)11/h5,8,11H,1,6-7H2,2-4H3/t8-,10-/m1/s1 |
| SMILE | CC(C)(O)[C@H]1CC[C@](C)(O1)C=C |
| CAS ID | 5989-33-3 |
| PubChem ID | 6428573 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | This is the cis form of furanoid linalool oxide, also called 'Linalool oxide B' or 'Linalool oxide I'; there are 2 possible stereo-isomers. cis-Linalool 3,6-oxide is found in many foods, some of which are tea, sweet basil, common oregano, and coriander. |
|---|