norharman
| Name(s) | norharman |
|---|---|
| Scientific name(s) | |
| Formula | C11H8N2 |
| Molecular mass | 168.1946 |
| IUPAC name | 9H-pyrido[3,4-b]indole |
| INCHI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
| SMILE | N1C2=CC=CC=C2C2=C1C=NC=C2 |
| CAS ID | 244-63-3 |
| PubChem ID | 64961 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | B-Carboline (9H-pyrido[3,4-b]indole) is an organic amine that is the prototype of a class of compounds known as b-carbolines. [HMDB]. Norharman is found in chicory. |
|---|