cichorioside c
| Name(s) | cichorioside c |
|---|---|
| Scientific name(s) | |
| Formula | C21H32O9 |
| Molecular mass | 428.4734 |
| IUPAC name | 4-hydroxy-3,6,10-trimethyl-9-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-2-one |
| INCHI | InChI=1S/C21H32O9/c1-9-4-5-13(29-21-19(26)18(25)17(24)15(8-22)30-21)10(2)7-14-16(12(23)6-9)11(3)20(27)28-14/h4,7,11-19,21-26H,5-6,8H2,1-3H3/b9-4-,10-7- |
| SMILE | CC1C2C(OC1=O)C=C(C)C(C\C=C(C)/CC2O)OC1OC(CO)C(O)C(O)C1O |
| CAS ID | 117013-50-0 |
| PubChem ID | Not available |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Cichorioside c is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cichorioside c can be found in chicory and endive, which makes cichorioside c a potential biomarker for the consumption of these food products. |
|---|