cellulose
| Name(s) | cellulose |
|---|---|
| Scientific name(s) | |
| Formula | C12H22O11 |
| Molecular mass | 342.2965 |
| IUPAC name | 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol |
| INCHI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2 |
| SMILE | OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
| CAS ID | 9004-34-6 |
| PubChem ID | 53477911 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | The most abundant organic material found in plants forming the principal constituent of their cell walls giving them structural strength. Anticaking agent, binding agent and other uses in food. |
|---|