3-o-feruloylquinic acid
| Name(s) | 3-o-feruloylquinic acid |
|---|---|
| Scientific name(s) | |
| Formula | C17H20O9 |
| Molecular mass | 368.3353 |
| IUPAC name | 1,3,4-trihydroxy-5-{[(2Z)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid |
| INCHI | InChI=1S/C17H20O9/c1-25-12-4-2-9(6-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3- |
| SMILE | COC1=C(O)C=C(\C=C/C(=O)OC2CC(O)(CC(O)C2O)C(O)=O)C=C1 |
| CAS ID | 62929-69-5 |
| PubChem ID | 5317346 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of coffee beansand is also from tomato (Lycopersicon esculentum) and sunflower (Helianthus annuus). 3-O-Feruloylquinic acid is found in many foods, some of which are chicory, fats and oils, garden tomato (variety), and coffee and coffee products. |
|---|