(±)-tryptophan
| Name(s) | (±)-tryptophan |
|---|---|
| Scientific name(s) | |
| Formula | C11H12N2O2 |
| Molecular mass | 204.2252 |
| IUPAC name | 2-amino-3-(1H-indol-3-yl)propanoic acid |
| INCHI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| SMILE | NC(CC1=CNC2=C1C=CC=C2)C(O)=O |
| CAS ID | 54-12-6 |
| PubChem ID | 1148 |
| DrugBank ID | Not available |
| CHEBI ID | 27897 |
| Description | Dietary supplement, nutrient_x000D_ _x000D_ Tryptophan is one of the 20 standard amino acids, as well as an essential amino acid in the human diet. Only the L-stereoisomer of tryptophan is used in structural or enzyme proteins, but the D-stereoisomer is occasionally found in naturally produced peptides (for example, the marine venom peptide contryphan). |
|---|