| Name(s) | p-menth-1-en-5-ol |
|---|---|
| Scientific name(s) | 3-methyl-6-propan-2-ylcyclohex-3-en-1-ol; p-mentha-1-ene-5-ol; p-menth-1(6)-en-3-ol; schembl11756835; 6-isopropyl-3-methyl-3-cyclohexen-1-ol; 3-methyl-6-(propan-2-yl)cyclohex-3-en-1-ol |
| Formula | C10H18O |
| Molecular mass | 154.2493 |
| IUPAC name | 3-methyl-6-propan-2-ylcyclohex-3-en-1-ol; 3-methyl-6-(propan-2-yl)cyclohex-3-en-1-ol |
| INCHI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h4,7,9-11H,5-6H2,1-3H3 |
| SMILE | CC(C)C1CC=C(C)CC1O |
| CAS ID | 55708-42-4 |
| PubChem ID | 68124095 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Piper nigrum (pepper). p-Menth-1-en-5-ol is found in herbs and spices, fruits, and pepper (spice). |
|---|