piperic acid
| Name(s) | piperic acid |
|---|---|
| Scientific name(s) | (e,e)-piperic acid; 5-(3,4-methylenedioxyphenyl)-2,4-pentadienoic acid; piperonic acid; piperic acid (e,e)-form; unii-gfg3fla9ur; (2e,4e)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| Formula | C12H10O4 |
| Molecular mass | 218.20 |
| IUPAC name | (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| INCHI | Not available |
| SMILE | OC(=O)\C=C\C=C/C1=CC2=C(OCO2)C=C1 |
| CAS ID | 136-72-1; 5285-18-7 |
| PubChem ID | 5370536 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Obtained from black pepper (Piper nigrum), from Minthostachys verticillata, peppermint (Mentha piperita) and others. Piperic acid is found in herbs and spices and pepper (spice). |
|---|