dihydroretrofractamide b
| Name(s) | dihydroretrofractamide b |
|---|---|
| Scientific name(s) | dihydrop ipercide; 10,11-dihydropipercide; schembl11305653; schembl11307682; chebi:174786; (2e,4e)-11-(1,3-benzodioxol-5-yl)-n-(2-methylpropyl)undeca-2,4-dienamide; (2e,4e)-11-(2h-1,3-benzodioxol-5-yl)-n-(2-methylpropyl)undeca-2,4-dienamide |
| Formula | C22H31NO3 |
| Molecular mass | 357.5 |
| IUPAC name | (2E,4E)-11-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)undeca-2,4-dienamide |
| INCHI | Not available |
| SMILE | CC(C)CNC(=O)\C=C\C=C\CCCCCCC1=CC2=C(OCO2)C=C1 |
| CAS ID | 75022-26-3 |
| PubChem ID | 10893678 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Alkaloid from the fruit of Piper nigrum (pepper). Dihydroretrofractamide B is found in herbs and spices and pepper (spice). |
|---|