| Name(s) | 4-methyltriacontane |
|---|---|
| Scientific name(s) | triacontane, 4-methyl; 4-methyl-triacontane; dtxsid80424008; lmfa11000434 |
| Formula | C31H64 |
| Molecular mass | 436.853 |
| IUPAC name | 4-methyltriacontane |
| INCHI | InChI=1S/C31H64/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-31(3)29-5-2/h31H,4-30H2,1-3H3 |
| SMILE | CCCCCCCCCCCCCCCCCCCCCCCCCCC(C)CCC |
| CAS ID | 77737-05-4 |
| PubChem ID | 6430733 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | 4-Methyltriacontane is a member of the class of compounds known as branched alkanes. Branched alkanes are acyclic branched hydrocarbons having the general formula CnH2n+2. Thus, 4-methyltriacontane is considered to be a hydrocarbon lipid molecule. 4-Methyltriacontane can be found in pepper (spice), which makes 4-methyltriacontane a potential biomarker for the consumption of this food product. |
|---|