| Name(s) | calamene |
|---|---|
| Scientific name(s) | |
| Formula | C10H12CLN5O4 |
| Molecular mass | 301.686 |
| IUPAC name | 2-(6-amino-8-chloro-9h-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| INCHI | InChI=1S/C10H12ClN5O4/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,13,14) |
| SMILE | NC1=NC=NC2=C1N=C(Cl)N2C1OC(CO)C(O)C1O |
| CAS ID | Not available |
| PubChem ID | 337175 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Calamene is a member of the class of compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. Calamene is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Calamene can be found in a number of food items such as common oregano, star anise, german camomile, and sweet bay, which makes calamene a potential biomarker for the consumption of these food products. |
|---|