| Name(s) | (e)-alpha-bergamotene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.3511 |
| IUPAC name | (1r,5r,6s)-2,6-dimethyl-6-(4-methylpent-3-en-1-yl)bicyclo[3.1.1]hept-2-ene |
| INCHI | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)13-8-7-12(3)14(15)10-13/h6-7,13-14H,5,8-10H2,1-4H3/t13-,14-,15+/m1/s1 |
| SMILE | CC(C)=CCC[C@@]1(C)[C@H]2C[C@@H]1C(C)=CC2 |
| CAS ID | Not available |
| PubChem ID | Not available |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | (e)-alpha-bergamotene is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other (e)-alpha-bergamotene can be found in a number of food items such as lime, sweet basil, cumin, and pepper (spice), which makes (e)-alpha-bergamotene a potential biomarker for the consumption of these food products. |
|---|