piperonal; 3,4-methylenedioxybenzaldehyde
| Name(s) | piperonal; 3,4-methylenedioxybenzaldehyde |
|---|---|
| Scientific name(s) | piperonal; piperonyl aldehyde; heliotropine; heliotropin; 1,3-benzodioxole-5-carbaldehyde; piperonaldehyde |
| Formula | C8H6O3 |
| Molecular mass | 150.133 |
| IUPAC name | 1,3-benzodioxole-5-carbaldehyde |
| INCHI | Not available |
| SMILE | [H]C(=O)C1=CC2=C(OCO2)C=C1 |
| CAS ID | 120-57-0 |
| PubChem ID | 8438 |
| DrugBank ID | Not available |
| CHEBI ID | 8240 |
| Description | Flavouring agent used in cherry and vanilla flavours. 3,4-Methylenedioxybenzaldehyde is found in pepper (spice), highbush blueberry, and vanilla. |
|---|