piperoleine b; piperolein b
| Name(s) | piperoleine b; piperolein b |
|---|---|
| Scientific name(s) | |
| Formula | C21H29NO3 |
| Molecular mass | 343.467 |
| IUPAC name | (8e)-9-(2h-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)non-8-en-1-one |
| INCHI | InChI=1S/C21H29NO3/c23-21(22-14-8-5-9-15-22)11-7-4-2-1-3-6-10-18-12-13-19-20(16-18)25-17-24-19/h6,10,12-13,16H,1-5,7-9,11,14-15,17H2/b10-6+ |
| SMILE | O=C(CCCCCC\C=C\C1=CC2=C(OCO2)C=C1)N1CCCCC1 |
| CAS ID | 30505-89-6 |
| PubChem ID | 21580213 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Minor constituent of Piper nigrum (black pepper). Piperolein B is found in herbs and spices and pepper (spice). |
|---|