| Name(s) | pelargonidin 3-o-rutinoside; pelargonidin 3-rutinoside |
|---|---|
| Scientific name(s) | |
| Formula | C27H31O14+ |
| Molecular mass | 579.531 |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-{[(2s,3r,4s,5s,6r)-3,4,5-trihydroxy-6-({[(2r,3r,4r,5r,6s)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-1$l^{4}-chromen-1-ylium |
| INCHI | InChI=1S/C27H30O14/c1-10-19(31)21(33)23(35)26(38-10)37-9-18-20(32)22(34)24(36)27(41-18)40-17-8-14-15(30)6-13(29)7-16(14)39-25(17)11-2-4-12(28)5-3-11/h2-8,10,18-24,26-27,31-36H,9H2,1H3,(H2-,28,29,30)/p+1/t10-,18+,19-,20+,21+,22-,23+,24+,26+,27+/m0/s1 |
| SMILE | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=CC4=C(O)C=C(O)C=C4[O+]=C3C3=CC=C(O)C=C3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| CAS ID | 33978-17-5 |
| PubChem ID | 443917 |
| DrugBank ID | Not available |
| CHEBI ID | 31968 |
| Description | Pelargonidin 3-rutinoside is a member of the class of compounds known as anthocyanidin-3-o-glycosides. Anthocyanidin-3-o-glycosides are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Pelargonidin 3-rutinoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Pelargonidin 3-rutinoside can be found in a number of food items such as gooseberry, lowbush blueberry, black chokeberry, and redcurrant, which makes pelargonidin 3-rutinoside a potential biomarker for the consumption of these food products. |
|---|