coriandrone b
| Name(s) | coriandrone b |
|---|---|
| Scientific name(s) | chebi:174778; 3-hydroxy-5-methoxy-2,2,8-trimethyl-3,4,7,8-tetrahydropyrano[4,3-h]chromen-10-one |
| Formula | C16H20O5 |
| Molecular mass | 292.33 |
| IUPAC name | 3-hydroxy-5-methoxy-2,2,8-trimethyl-3,4,7,8-tetrahydropyrano[4,3-h]chromen-10-one |
| INCHI | Not available |
| SMILE | COC1=C2CC(O)C(C)(C)OC2=C2C(=O)OC(C)CC2=C1 |
| CAS ID | 139906-04-0 |
| PubChem ID | 131752232 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Coriandrum sativum (coriander). Coriandrone B is found in coriander and herbs and spices. |
|---|