coriandrin
| Name(s) | coriandrin |
|---|---|
| Scientific name(s) | 4-methoxy-7-methylfuro[2,3-g]isochromen-5-one; 4-methoxy-7-methyl-5h-furo(2,3-g)benzopyran-5-one; ccris 8086; cariandrin; dtxsid00151389; chebi:174178 |
| Formula | C13H10O4 |
| Molecular mass | 230.22 |
| IUPAC name | 4-methoxy-7-methylfuro[2,3-g]isochromen-5-one |
| INCHI | Not available |
| SMILE | COC1=C2C(=O)OC(C)=CC2=CC2=C1C=CO2 |
| CAS ID | 116408-80-1 |
| PubChem ID | 119586 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Coriandrum sativum (coriander). Coriandrin is found in coriander and herbs and spices. |
|---|