petroselinic acid; petroselic acid
| Name(s) | petroselinic acid; petroselic acid |
|---|---|
| Scientific name(s) | |
| Formula | C18H34O2 |
| Molecular mass | 282.4614 |
| IUPAC name | (6z)-octadec-6-enoic acid |
| INCHI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3,(H,19,20)/b13-12- |
| SMILE | CCCCCCCCCCC\C=C/CCCCC(O)=O |
| CAS ID | 593-39-5 |
| PubChem ID | 5281125 |
| DrugBank ID | Not available |
| CHEBI ID | 28194 |
| Description | Found in umbelliferous seed oils e.g. major constituent of oils of parsley, ivy, fennel, celery and others [DFC]. |
|---|