m-methylacetophenone; m-methyl acetophenone
| Name(s) | m-methylacetophenone; m-methyl acetophenone |
|---|---|
| Scientific name(s) | |
| Formula | C9H10O |
| Molecular mass | 134.178 |
| IUPAC name | sodium hydrogen (3-acetamidophenyl)arsonate |
| INCHI | InChI=1S/C8H10AsNO4.Na/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)14;/h2-5H,1H3,(H,10,11)(H2,12,13,14);/q;+1/p-1 |
| SMILE | [Na+].CC(=O)NC1=CC=CC(=C1)[As](O)([O-])=O |
| CAS ID | Not available |
| PubChem ID | 11455 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | M-methyl acetophenone is soluble (in water) and a weakly acidic compound (based on its pKa). M-methyl acetophenone can be found in pepper (spice), which makes M-methyl acetophenone a potential biomarker for the consumption of this food product. |
|---|