(-)-matairesinol
| Name(s) | (-)-matairesinol |
|---|---|
| Scientific name(s) | |
| Formula | C20H34O6 |
| Molecular mass | 370.486 |
| IUPAC name | (3r,4r)-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| INCHI | InChI=1S/C20H34O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h12-19,21-22H,3-11H2,1-2H3 |
| SMILE | COC1CC(CC2COC(=O)C2CC2CCC(O)C(C2)OC)CCC1O |
| CAS ID | 580-72-3 |
| PubChem ID | 119205 |
| DrugBank ID | DB04200 |
| CHEBI ID | Not available |
| Description | Matairesinol is a plant lignan. It occurs with secoisolariciresinol in numerous foods such as oil seeds, whole grains, vegetables, and fruits. (-)-Matairesinol is found in many foods, some of which are caraway, pecan nut, cereals and cereal products, and longan. |
|---|