| Name(s) | carpasemine |
|---|---|
| Scientific name(s) | benzylthiourea; 1-benzylthiourea; 1-benzyl-2-thiourea; n-benzylthiourea; thiourea, (phenylmethyl)-; urea, 1-benzyl-2-thio- |
| Formula | C8H10N2S |
| Molecular mass | 166.243 |
| IUPAC name | benzylthiourea |
| INCHI | InChI=1S/C8H10N2S/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10,11) |
| SMILE | NC(=S)NCC1=CC=CC=C1 |
| CAS ID | 621-83-0 |
| PubChem ID | 737375 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Carpasemine, also known as 1-benzylthiourea or benzylthiouronium chloride, belongs to benzene and substituted derivatives class of compounds. Those are aromatic compounds containing one monocyclic ring system consisting of benzene. Carpasemine is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Carpasemine can be found in papaya, which makes carpasemine a potential biomarker for the consumption of this food product. |
|---|