5-dehydro-avenasterol
| Name(s) | 5-dehydro-avenasterol |
|---|---|
| Scientific name(s) | |
| Formula | C29H50O |
| Molecular mass | 414.7067 |
| IUPAC name | (2s,5s,15r)-2,15-dimethyl-14-[(2r,5z)-5-(propan-2-yl)hept-5-en-2-yl]tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-5-ol |
| INCHI | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,19-20,22-27,30H,8-18H2,1-6H3/b21-7-/t20-,22?,23+,24?,25?,26?,27?,28+,29-/m1/s1 |
| SMILE | C\C=C(\CC[C@@H](C)C1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)C(C)C |
| CAS ID | Not available |
| PubChem ID | Not available |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | 5-dehydro-avenasterol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 5-dehydro-avenasterol can be found in a number of food items such as common hazelnut, garden onion, corn, and papaya, which makes 5-dehydro-avenasterol a potential biomarker for the consumption of these food products. |
|---|