retrofractamide a
| Name(s) | retrofractamide a |
|---|---|
| Scientific name(s) | |
| Formula | C20H25NO3 |
| Molecular mass | 327.424 |
| IUPAC name | (2e,4e,8e)-9-(2h-1,3-benzodioxol-5-yl)-n-(2-methylpropyl)nona-2,4,8-trienamide |
| INCHI | InChI=1S/C20H25NO3/c1-16(2)14-21-20(22)10-8-6-4-3-5-7-9-17-11-12-18-19(13-17)24-15-23-18/h4,6-13,16H,3,5,14-15H2,1-2H3,(H,21,22)/b6-4+,9-7+,10-8+ |
| SMILE | CC(C)CNC(=O)\C=C\C=C\CC\C=C\C1=CC2=C(OCO2)C=C1 |
| CAS ID | 94079-67-1 |
| PubChem ID | 11012859 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Alkaloid from the above-ground parts of Piper retrofractum (Javanese long pepper) and the fruits of Piper nigrum (pepper). Retrofractamide A is found in herbs and spices and pepper (spice). |
|---|