piperine; isopiperine
| Name(s) | piperine; isopiperine |
|---|---|
| Scientific name(s) | bioperine; 1-piperoylpiperidine; piperin; 7780-20-3; (e,e)-1-piperoylpiperidine; fema no. 2909 |
| Formula | C17H19NO3 |
| Molecular mass | 285.33766 |
| IUPAC name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| INCHI | Not available |
| SMILE | O=C(\C=C\C=C\C1=CC2=C(OCO2)C=C1)N1CCCCC1 |
| CAS ID | 94-62-2 |
| PubChem ID | 638024 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of pepper (Piper nigrum) (Piperaceae). Isopiperine is found in herbs and spices and pepper (spice). |
|---|