pentyl acetate
| Name(s) | pentyl acetate |
|---|---|
| Scientific name(s) | amyl acetate; n-amyl acetate; n-pentyl acetate; acetic acid, pentyl ester; amyl acetic ester; 1-pentyl acetate |
| Formula | C7H14O2 |
| Molecular mass | 130.18 |
| IUPAC name | pentyl acetate |
| INCHI | InChI=1S/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
| SMILE | CCCCCOC(C)=O |
| CAS ID | 628-63-7 |
| PubChem ID | 12348 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Flavouring agent. Pentyl acetate is found in many foods, some of which are cocoa bean, sweet bay, peach, and apple. |
|---|