| Name(s) | 24-methylenecycloartan-3-ol |
|---|---|
| Scientific name(s) | 24-methylenecycloartanol; 24-methylene cycloartanol; chebi:1307; 24(28)-methylenecycloartanol; unii-fi34181g3x; chembl376350 |
| Formula | C31H52O |
| Molecular mass | 440.744 |
| IUPAC name | (1S,3R,6S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methyl-5-methylideneheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol; (1s,3r,6s,8r,11s,12s,15r,16r)-7,7,12,16-tetramethyl-15-[(2r)-6-methyl-5-methylideneheptan-2-yl]pentacyclo[9.7.0.0^{1,3}.0^{3,8}.0^{12,16}]octadecan-6-ol |
| INCHI | InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h20,22-26,32H,3,9-19H2,1-2,4-8H3/t22-,23-,24+,25+,26+,28-,29+,30-,31+/m1/s1 |
| SMILE | [H][C@@]12CC[C@]3([H])[C@]4(C[C@@]14CC[C@]1(C)[C@H](CC[C@@]21C)[C@H](C)CCC(=C)C(C)C)CC[C@H](O)C3(C)C |
| CAS ID | 1449-09-8 |
| PubChem ID | 94204 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | 24-methylenecycloartan-3-ol belongs to cycloartanols and derivatives class of compounds. Those are steroids containing a cycloartanol moiety. 24-methylenecycloartan-3-ol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 24-methylenecycloartan-3-ol can be found in a number of food items such as oregon yampah, common persimmon, pineapple, and climbing bean, which makes 24-methylenecycloartan-3-ol a potential biomarker for the consumption of these food products. |
|---|