4-butyl-gamma-butyrolactone
| Name(s) | 4-butyl-gamma-butyrolactone |
|---|---|
| Scientific name(s) | gamma-octalactone; gamma-octanoic lactone; 5-butyldihydrofuran-2(3h)-one; 4-octanolide; 5-butyloxolan-2-one; octan-4-olide |
| Formula | C8H14O2 |
| Molecular mass | 142.20 |
| IUPAC name | 5-butyloxolan-2-one |
| INCHI | InChI=1S/C8H14O2/c1-2-3-4-7-5-6-8(9)10-7/h7H,2-6H2,1H3 |
| SMILE | CCCCC1CCC(=O)O1 |
| CAS ID | 104-50-7 |
| PubChem ID | 7704 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Present in apricots, peaches and other fruits. Flavouring ingredient [DFC]. 4-Butyl-gamma-butyrolactone is found in many foods, some of which are peach, bilberry, papaya, and pineapple. |
|---|