| Name(s) | kaempferol 3-glucuronide |
|---|---|
| Scientific name(s) | |
| Formula | C21H18O12 |
| Molecular mass | 462.3604 |
| IUPAC name | 6-{[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4h-chromen-3-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
| INCHI | InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)17-18(13(25)12-10(24)5-9(23)6-11(12)31-17)32-21-16(28)14(26)15(27)19(33-21)20(29)30/h1-6,14-16,19,21-24,26-28H,(H,29,30) |
| SMILE | OC1C(O)C(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)OC(C1O)C(O)=O |
| CAS ID | 22688-78-4 |
| PubChem ID | 14185731 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from the leaves of Euphorbia lathyris, Euphorbia cyparissias, Anemone alpina and Phaseolus vulgaris (kidney bean) and many other plants [CCD]. Kaempferol 3-glucuronide is found in many foods, some of which are dill, fennel, strawberry, and green bean. |
|---|