| Name(s) | serotonin |
|---|---|
| Scientific name(s) | 5-hydroxytryptamine; 3-(2-aminoethyl)-1h-indol-5-ol; enteramine; thrombotonin; 5-ht; thrombocytin |
| Formula | C10H12N2O |
| Molecular mass | 176.21 |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-5-ol |
| INCHI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| SMILE | NCCC1=CNC2=CC=C(O)C=C12 |
| CAS ID | 50-67-9 |
| PubChem ID | 5202 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from bananas and other fruitsand is also from cotton (Gossypium hirsutum) [DFC]. Serotonin is found in many foods, some of which are common pea, eggplant, swiss chard, and dill. |
|---|