| Name(s) | b-bisabolene; s-beta-bisabolene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | 1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohex-1-ene |
| INCHI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,15H,4-5,7,9-11H2,1-3H3 |
| SMILE | CC(C)=CCCC(=C)C1CCC(C)=CC1 |
| CAS ID | 495-61-4 |
| PubChem ID | 403919 |
| DrugBank ID | Not available |
| CHEBI ID | 49263 |
| Description | Constituent of the essential oils of bergamot, lemon and wild carrot. S-beta-Bisabolene is found in many foods, some of which are roman camomile, anise, wild carrot, and common oregano. |
|---|