| Name(s) | tricosanoic acid |
|---|---|
| Scientific name(s) | |
| Formula | C23H46O2 |
| Molecular mass | 354.619 |
| IUPAC name | tricosanoic acid |
| INCHI | InChI=1S/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-22H2,1H3,(H,24,25) |
| SMILE | CCCCCCCCCCCCCCCCCCCCCCC(O)=O |
| CAS ID | 929-77-1; 2433-96-7 |
| PubChem ID | 17085 |
| DrugBank ID | DB03500 |
| CHEBI ID | 42394 |
| Description | Constituent of Citrus bergamia (bergamot orange) oil Tricosanoic acid is found in different plant oils and extracts such as the Brazilian peppertree, but it can also be produced in the human body. It has shown to be a hair growth stimulant. |
|---|