taraxasterol
| Name(s) | taraxasterol |
|---|---|
| Scientific name(s) | |
| Formula | C30H50O |
| Molecular mass | 426.73 |
| IUPAC name | 4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-docosahydropicen-3-ol |
| INCHI | InChI=1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3 |
| SMILE | CC1C2C3CCC4C5(C)CCC(O)C(C)(C)C5CCC4(C)C3(C)CCC2(C)CCC1=C |
| CAS ID | 1059-14-9 |
| PubChem ID | 115250 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of dandelion roots (Taraxacum officinale), Roman chamomile flowers (Anthemis nobilis) and many other plants. Taraxasterol is found in many foods, some of which are soy bean, chicory, evening primrose, and common grape. |
|---|