p-mentha-1,8-dien-4-ol
| Name(s) | p-mentha-1,8-dien-4-ol |
|---|---|
| Scientific name(s) | 4-methyl-1-(prop-1-en-2-yl)cyclohex-3-enol; 1,8-menthadien-4-ol; 4-methyl-1-prop-1-en-2-ylcyclohex-3-en-1-ol; limonene-4-ol; limonen-4-ol; 1,8-menthadiene-4-ol |
| Formula | C10H16O |
| Molecular mass | 152.23 |
| IUPAC name | 4-methyl-1-prop-1-en-2-ylcyclohex-3-en-1-ol |
| INCHI | InChI=1S/C10H16O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,11H,1,5-7H2,2-3H3 |
| SMILE | CC(=C)C1(O)CCC(C)=CC1 |
| CAS ID | 3419-02-1 |
| PubChem ID | 527428 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Japanese pepper tree (Zanthoxylum piperitum), yuzu (Citrus junos), and spearmint (Mentha spicata) oils. p-Mentha-1,8-dien-4-ol is found in many foods, some of which are spearmint, pepper (spice), caraway, and blackcurrant. |
|---|