(1s,4s)-dihydrocarvone
| Name(s) | (1s,4s)-dihydrocarvone |
|---|---|
| Scientific name(s) | (-)-dihydrocarvone; l-dihydrocarvone; (2s,5s)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone; unii-n7yti5w4u2; n7yti5w4u2; (2s,5s)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
| Formula | C10H16O |
| Molecular mass | 152.23 |
| IUPAC name | (2S,5S)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
| INCHI | Not available |
| SMILE | C[C@H]1CC[C@@H](CC1=O)C(C)=C |
| CAS ID | 619-02-3; 6909-25-7 |
| PubChem ID | 443183 |
| DrugBank ID | Not available |
| CHEBI ID | 168 |
| Description | Constituent of caraway, dill and mint oils. (1S,4S)-Dihydrocarvone is found in many foods, some of which are herbs and spices, caraway, dill, and mentha (mint). |
|---|