| Name(s) | dihydrocarvone |
|---|---|
| Scientific name(s) | (+)-dihydrocarvone; p-menth-8-en-2-one; 1,6-dihydrocarvone; 2-methyl-5-(1-methylethenyl)cyclohexanone; 2-methyl-5-prop-1-en-2-ylcyclohexan-1-one; 8-p-menthen-2-one |
| Formula | C10H16O |
| Molecular mass | 152.23 |
| IUPAC name | 2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
| INCHI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3 |
| SMILE | CC1CCC(CC1=O)C(C)=C |
| CAS ID | 7764-50-3 |
| PubChem ID | 24473 |
| DrugBank ID | Not available |
| CHEBI ID | 23733 |
| Description | Flavouring agent with spearmint-like flavour. Dihydrocarvone is found in many foods, some of which are dill, peppermint, pepper (spice), and caraway. |
|---|