moracin i
| Name(s) | moracin i |
|---|---|
| Scientific name(s) | |
| Formula | C20H20O4 |
| Molecular mass | 324.376 |
| IUPAC name | 2-[5-hydroxy-3-methoxy-2-(3-methylbut-2-en-1-yl)phenyl]-1-benzofuran-6-ol |
| INCHI | InChI=1S/C20H20O4/c1-12(2)4-7-16-17(9-15(22)11-19(16)23-3)20-8-13-5-6-14(21)10-18(13)24-20/h4-6,8-11,21-22H,7H2,1-3H3 |
| SMILE | COC1=CC(O)=CC(C2=CC3=C(O2)C=C(O)C=C3)=C1CC=C(C)C |
| CAS ID | 73338-88-2 |
| PubChem ID | 155976 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Morus alba (white mulberry) infected with Fusarium solani. Moracin I is found in mulberry and fruits. |
|---|