| Name(s) | moracing; moracin g |
|---|---|
| Scientific name(s) | |
| Formula | C19H16O4 |
| Molecular mass | 308.333 |
| IUPAC name | 5-{12-methyl-3,10-dioxatricyclo[7.5.0.0²,?]tetradeca-1,4,6,8,12-pentaen-4-yl}benzene-1,3-diol |
| INCHI | InChI=1S/C19H16O4/c1-11-2-4-16-17(22-10-11)5-3-12-8-18(23-19(12)16)13-6-14(20)9-15(21)7-13/h2-3,5-9,20-21H,4,10H2,1H3 |
| SMILE | CC1=CCC2=C(OC1)C=CC1=C2OC(=C1)C1=CC(O)=CC(O)=C1 |
| CAS ID | 73338-86-0 |
| PubChem ID | 5319890 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Morus alba (white mulberry) infected with Fusarium solani. Moracin G is found in mulberry and fruits. |
|---|