moracind; moracin d
| Name(s) | moracind; moracin d |
|---|---|
| Scientific name(s) | |
| Formula | C19H16O4 |
| Molecular mass | 308.333 |
| IUPAC name | 7-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethyl-2h-chromen-5-ol |
| INCHI | InChI=1S/C19H16O4/c1-19(2)6-5-14-15(21)7-12(9-18(14)23-19)16-8-11-3-4-13(20)10-17(11)22-16/h3-10,20-21H,1-2H3 |
| SMILE | CC1(C)OC2=CC(=CC(O)=C2C=C1)C1=CC2=C(O1)C=C(O)C=C2 |
| CAS ID | 69120-07-6 |
| PubChem ID | 641378 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Morus alba (white mulberry) infected with Fusarium solani. Moracin D is found in mulberry and fruits. |
|---|