moracinc; moracin c
| Name(s) | moracinc; moracin c |
|---|---|
| Scientific name(s) | |
| Formula | C19H18O4 |
| Molecular mass | 310.349 |
| IUPAC name | 5-(6-hydroxy-1-benzofuran-2-yl)-2-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
| INCHI | InChI=1S/C19H18O4/c1-11(2)3-6-15-16(21)7-13(8-17(15)22)18-9-12-4-5-14(20)10-19(12)23-18/h3-5,7-10,20-22H,6H2,1-2H3 |
| SMILE | CC(C)=CCC1=C(O)C=C(C=C1O)C1=CC2=CC=C(O)C=C2O1 |
| CAS ID | 69120-06-5 |
| PubChem ID | 155248 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from Morus alba (white mulberry) infected with Fusarium solani. Moracin C is found in mulberry and fruits. |
|---|