dl-phenylalanine; (±)-phenylalanine
| Name(s) | dl-phenylalanine; (±)-phenylalanine |
|---|---|
| Scientific name(s) | |
| Formula | C9H11NO2 |
| Molecular mass | 165.1891 |
| IUPAC name | 2-amino-3-phenylpropanoic acid |
| INCHI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| SMILE | NC(CC1=CC=CC=C1)C(O)=O |
| CAS ID | 150-30-1 |
| PubChem ID | 994 |
| DrugBank ID | Not available |
| CHEBI ID | 28044 |
| Description | Flavouring ingredient. (±)-Phenylalanine is found in many foods, some of which are cucumber, green bell pepper, yellow bell pepper, and saskatoon berry. |
|---|